C13H17F2N3O3 — CID 79882227
N-carbamoyl-2-[4-(ethylaminomethyl)-2,6-difluorophenoxy]propanamide (PubChem CID 79882227) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is N-carbamoyl-2-[4-(ethylaminomethyl)-2,6-difluorophenoxy]propanamide.
| Compound Name | N-carbamoyl-2-[4-(ethylaminomethyl)-2,6-difluorophenoxy]propanamide |
|---|---|
| PubChem CID | 79882227 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-carbamoyl-2-[4-(ethylaminomethyl)-2,6-difluorophenoxy]propanamide |
| SMILES | CCNCc1cc(F)c(OC(C)C(=O)NC(N)=O)c(F)c1 |
| InChI | InChI=1S/C13H17F2N3O3/c1-3-17-6-8-4-9(14)11(10(15)5-8)21-7(2)12(19)18-13(16)20/h4-5,7,17H,3,6H2,1-2H3,(H3,16,18,19,20) |
| InChIKey | JIOFCIPVQXPKOB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |