C14H20Cl2N2O2 — CID 62900773
2-[2,4-dichloro-6-[(propan-2-ylamino)methyl]phenoxy]butanamide (PubChem CID 62900773) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 2-[2,4-dichloro-6-[(propan-2-ylamino)methyl]phenoxy]butanamide.
| Compound Name | 2-[2,4-dichloro-6-[(propan-2-ylamino)methyl]phenoxy]butanamide |
|---|---|
| PubChem CID | 62900773 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[2,4-dichloro-6-[(propan-2-ylamino)methyl]phenoxy]butanamide |
| SMILES | CCC(Oc1c(Cl)cc(Cl)cc1CNC(C)C)C(N)=O |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-4-12(14(17)19)20-13-9(7-18-8(2)3)5-10(15)6-11(13)16/h5-6,8,12,18H,4,7H2,1-3H3,(H2,17,19) |
| InChIKey | CBTRJQWHXSPNDC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |