C15H22Cl2N2O2 — CID 63057973
2-[2-[(tert-butylamino)methyl]-4,6-dichlorophenoxy]butanamide (PubChem CID 63057973) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 2-[2-[(tert-butylamino)methyl]-4,6-dichlorophenoxy]butanamide.
| Compound Name | 2-[2-[(tert-butylamino)methyl]-4,6-dichlorophenoxy]butanamide |
|---|---|
| PubChem CID | 63057973 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[2-[(tert-butylamino)methyl]-4,6-dichlorophenoxy]butanamide |
| SMILES | CCC(Oc1c(Cl)cc(Cl)cc1CNC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C15H22Cl2N2O2/c1-5-12(14(18)20)21-13-9(8-19-15(2,3)4)6-10(16)7-11(13)17/h6-7,12,19H,5,8H2,1-4H3,(H2,18,20) |
| InChIKey | QFIFRNDOECEMFM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |