C14H19Cl2NO3 — CID 83037579
2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]pentanoic acid (PubChem CID 83037579) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]pentanoic acid.
| Compound Name | 2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 83037579 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]pentanoic acid |
| SMILES | CCCC(Oc1c(Cl)cc(Cl)cc1CNCC)C(=O)O |
| InChI | InChI=1S/C14H19Cl2NO3/c1-3-5-12(14(18)19)20-13-9(8-17-4-2)6-10(15)7-11(13)16/h6-7,12,17H,3-5,8H2,1-2H3,(H,18,19) |
| InChIKey | UEDPWOFTTMRABF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |