C14H14Cl2O5 — CID 83040523
2-[2-[(E)-2-carboxyethenyl]-4,6-dichlorophenoxy]pentanoic acid (PubChem CID 83040523) has the molecular formula C14H14Cl2O5 and a molecular weight of 333.17 g/mol. Its IUPAC name is 2-[2-[(E)-2-carboxyethenyl]-4,6-dichlorophenoxy]pentanoic acid.
| Compound Name | 2-[2-[(E)-2-carboxyethenyl]-4,6-dichlorophenoxy]pentanoic acid |
|---|---|
| PubChem CID | 83040523 |
| Molecular Formula | C14H14Cl2O5 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-[2-[(E)-2-carboxyethenyl]-4,6-dichlorophenoxy]pentanoic acid |
| SMILES | CCCC(Oc1c(Cl)cc(Cl)cc1/C=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H14Cl2O5/c1-2-3-11(14(19)20)21-13-8(4-5-12(17)18)6-9(15)7-10(13)16/h4-7,11H,2-3H2,1H3,(H,17,18)(H,19,20)/b5-4+ |
| InChIKey | GFWVLVVIRMPLRD-SNAWJCMRSA-N |
| XLogP | 3.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|