3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid

C13H10Cl2O3 — CID 76939175

IUPAC3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid
SMILESCC#CCOc1c(Cl)cc(Cl)cc1C=CC(=O)O
InChIInChI=1S/C13H10Cl2O3/c1-2-3-6-18-13-9(4-5-12(16)17)7-10(14)8-11(13)15/h4-5,7-8H,6H2,1H3,(H,16,17)
InChIKeyULNOFTOFRYLRMP-UHFFFAOYSA-N
MW285.13 g/mol
LogP3.49
Rot. Bonds4

About 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid

3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid (PubChem CID 76939175) has the molecular formula C13H10Cl2O3 and a molecular weight of 285.13 g/mol. Its IUPAC name is 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid
PubChem CID76939175
Molecular FormulaC13H10Cl2O3
Molecular Weight285.13 g/mol
Exact Mass284.00
IUPAC Name3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid
SMILESCC#CCOc1c(Cl)cc(Cl)cc1C=CC(=O)O
InChIInChI=1S/C13H10Cl2O3/c1-2-3-6-18-13-9(4-5-12(16)17)7-10(14)8-11(13)15/h4-5,7-8H,6H2,1H3,(H,16,17)
InChIKeyULNOFTOFRYLRMP-UHFFFAOYSA-N
XLogP3.49
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.13
LogP ≤ 53.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid?
The IUPAC name of 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid (CID 76939175) is 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid.
What is the SMILES notation for 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid?
The canonical SMILES for 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid is CC#CCOc1c(Cl)cc(Cl)cc1C=CC(=O)O.
What is the InChIKey of 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid?
The InChIKey is ULNOFTOFRYLRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2O3/c1-2-3-6-18-13-9(4-5-12(16)17)7-10(14)8-11(13)15/h4-5,7-8H,6H2,1H3,(H,16,17).
What are the key properties of 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid?
3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid has a molecular weight of 285.13 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-but-2-ynoxy-3,5-dichlorophenyl)prop-2-enoic acid is sourced from PubChem (CID 76939175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).