C14H12O5 — CID 76939182
3-(6-but-2-ynoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid (PubChem CID 76939182) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-(6-but-2-ynoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid.
| Compound Name | 3-(6-but-2-ynoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 76939182 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-(6-but-2-ynoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid |
| SMILES | CC#CCOc1cc2c(cc1C=CC(=O)O)OCO2 |
| InChI | InChI=1S/C14H12O5/c1-2-3-6-17-11-8-13-12(18-9-19-13)7-10(11)4-5-14(15)16/h4-5,7-8H,6,9H2,1H3,(H,15,16) |
| InChIKey | NARCCHAUQZGROL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|