C14H14O7 — CID 77055260
2-[[6-(2-carboxyethenyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid (PubChem CID 77055260) has the molecular formula C14H14O7 and a molecular weight of 294.26 g/mol. Its IUPAC name is 2-[[6-(2-carboxyethenyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid.
| Compound Name | 2-[[6-(2-carboxyethenyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 77055260 |
| Molecular Formula | C14H14O7 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[[6-(2-carboxyethenyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid |
| SMILES | CCC(Oc1cc2c(cc1C=CC(=O)O)OCO2)C(=O)O |
| InChI | InChI=1S/C14H14O7/c1-2-9(14(17)18)21-10-6-12-11(19-7-20-12)5-8(10)3-4-13(15)16/h3-6,9H,2,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | OMFAJUKYJDEIEB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|