C12H10F2O5 — CID 55012867
(E)-3-[6-(2,2-difluoroethoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid (PubChem CID 55012867) has the molecular formula C12H10F2O5 and a molecular weight of 272.20 g/mol. Its IUPAC name is (E)-3-[6-(2,2-difluoroethoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(2,2-difluoroethoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 55012867 |
| Molecular Formula | C12H10F2O5 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (E)-3-[6-(2,2-difluoroethoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc2c(cc1OCC(F)F)OCO2 |
| InChI | InChI=1S/C12H10F2O5/c13-11(14)5-17-8-4-10-9(18-6-19-10)3-7(8)1-2-12(15)16/h1-4,11H,5-6H2,(H,15,16)/b2-1+ |
| InChIKey | VGIOZRJOXJDHLY-OWOJBTEDSA-N |
| XLogP | 2.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|