C10H8O4 — CID 45053203
(Z)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid (PubChem CID 45053203) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid.
| Compound Name | (Z)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 45053203 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C\c1cccc2c1OCO2 |
| InChI | InChI=1S/C10H8O4/c11-9(12)5-4-7-2-1-3-8-10(7)14-6-13-8/h1-5H,6H2,(H,11,12)/b5-4- |
| InChIKey | NWSIULATLGKZGF-PLNGDYQASA-N |
| XLogP | 1.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|