C12H13NO3 — CID 170876951
(Z)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)prop-2-enamide (PubChem CID 170876951) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)prop-2-enamide.
| Compound Name | (Z)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170876951 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (Z)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)prop-2-enamide |
| SMILES | NC(=O)/C=C\c1cccc2c1OCCCO2 |
| InChI | InChI=1S/C12H13NO3/c13-11(14)6-5-9-3-1-4-10-12(9)16-8-2-7-15-10/h1,3-6H,2,7-8H2,(H2,13,14)/b6-5- |
| InChIKey | NBULOHKMTCPPEG-WAYWQWQTSA-N |
| XLogP | 1.35 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|