C19H17FO4 — CID 103598024
3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 103598024) has the molecular formula C19H17FO4 and a molecular weight of 328.34 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 103598024 |
| Molecular Formula | C19H17FO4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cccc3c2OCCCO3)c(F)c1 |
| InChI | InChI=1S/C19H17FO4/c1-22-14-7-8-15(16(20)12-14)17(21)9-6-13-4-2-5-18-19(13)24-11-3-10-23-18/h2,4-9,12H,3,10-11H2,1H3 |
| InChIKey | YUYFWRYLSFZLLI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|