C21H22O5 — CID 86902830
(E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one (PubChem CID 86902830) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 86902830 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)-1-(4,5-dimethoxy-2-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C)c(C(=O)/C=C/c2cccc3c2OCCCO3)cc1OC |
| InChI | InChI=1S/C21H22O5/c1-14-12-19(23-2)20(24-3)13-16(14)17(22)9-8-15-6-4-7-18-21(15)26-11-5-10-25-18/h4,6-9,12-13H,5,10-11H2,1-3H3/b9-8+ |
| InChIKey | DRUBQUFQOUGMNS-CMDGGOBGSA-N |
| XLogP | 4.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|