C14H12O6 — CID 10707578
(E)-3-[5-[(E)-2-carboxyethenyl]-2,3-dihydro-1,4-benzodioxin-8-yl]prop-2-enoic acid (PubChem CID 10707578) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is (E)-3-[5-[(E)-2-carboxyethenyl]-2,3-dihydro-1,4-benzodioxin-8-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(E)-2-carboxyethenyl]-2,3-dihydro-1,4-benzodioxin-8-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10707578 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (E)-3-[5-[(E)-2-carboxyethenyl]-2,3-dihydro-1,4-benzodioxin-8-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C=C/C(=O)O)c2c1OCCO2 |
| InChI | InChI=1S/C14H12O6/c15-11(16)5-3-9-1-2-10(4-6-12(17)18)14-13(9)19-7-8-20-14/h1-6H,7-8H2,(H,15,16)(H,17,18)/b5-3+,6-4+ |
| InChIKey | VMUVWHFFHBPTJK-GGWOSOGESA-N |
| XLogP | 1.65 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|