C10H10O2 — CID 102486201
4-[(E)-prop-1-enyl]-1,3-benzodioxole (PubChem CID 102486201) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-[(E)-prop-1-enyl]-1,3-benzodioxole.
| Compound Name | 4-[(E)-prop-1-enyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 102486201 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 4-[(E)-prop-1-enyl]-1,3-benzodioxole |
| SMILES | C/C=C/c1cccc2c1OCO2 |
| InChI | InChI=1S/C10H10O2/c1-2-4-8-5-3-6-9-10(8)12-7-11-9/h2-6H,7H2,1H3/b4-2+ |
| InChIKey | BLTZBNMFKAUMRR-DUXPYHPUSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |