(E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid

C11H10O5 — CID 62343893

IUPAC(E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid
SMILESO=C(O)/C=C/COc1ccc2c(c1)OCO2
InChIInChI=1S/C11H10O5/c12-11(13)2-1-5-14-8-3-4-9-10(6-8)16-7-15-9/h1-4,6H,5,7H2,(H,12,13)/b2-1+
InChIKeyZEZJWWWXPWLTBZ-OWOJBTEDSA-N
MW222.20 g/mol
LogP1.43
Rot. Bonds4

About (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid

(E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid (PubChem CID 62343893) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid.

Molecular Properties

Compound Name(E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid
PubChem CID62343893
Molecular FormulaC11H10O5
Molecular Weight222.20 g/mol
Exact Mass222.05
IUPAC Name(E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid
SMILESO=C(O)/C=C/COc1ccc2c(c1)OCO2
InChIInChI=1S/C11H10O5/c12-11(13)2-1-5-14-8-3-4-9-10(6-8)16-7-15-9/h1-4,6H,5,7H2,(H,12,13)/b2-1+
InChIKeyZEZJWWWXPWLTBZ-OWOJBTEDSA-N
XLogP1.43
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.20
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid?
The IUPAC name of (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid (CID 62343893) is (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid.
What is the SMILES notation for (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid?
The canonical SMILES for (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid is O=C(O)/C=C/COc1ccc2c(c1)OCO2.
What is the InChIKey of (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid?
The InChIKey is ZEZJWWWXPWLTBZ-OWOJBTEDSA-N. The full InChI is InChI=1S/C11H10O5/c12-11(13)2-1-5-14-8-3-4-9-10(6-8)16-7-15-9/h1-4,6H,5,7H2,(H,12,13)/b2-1+.
What are the key properties of (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid?
(E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid has a molecular weight of 222.20 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(1,3-benzodioxol-5-yloxy)but-2-enoic acid is sourced from PubChem (CID 62343893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).