C10H8F2O3 — CID 76949345
4-(3,5-difluorophenoxy)but-2-enoic acid (PubChem CID 76949345) has the molecular formula C10H8F2O3 and a molecular weight of 214.17 g/mol. Its IUPAC name is 4-(3,5-difluorophenoxy)but-2-enoic acid.
| Compound Name | 4-(3,5-difluorophenoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 76949345 |
| Molecular Formula | C10H8F2O3 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 4-(3,5-difluorophenoxy)but-2-enoic acid |
| SMILES | O=C(O)C=CCOc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H8F2O3/c11-7-4-8(12)6-9(5-7)15-3-1-2-10(13)14/h1-2,4-6H,3H2,(H,13,14) |
| InChIKey | WXCHPOXOMSPCIQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|