4-(3,5-difluorophenoxy)but-2-enoic acid

C10H8F2O3 — CID 76949345

IUPAC4-(3,5-difluorophenoxy)but-2-enoic acid
SMILESO=C(O)C=CCOc1cc(F)cc(F)c1
InChIInChI=1S/C10H8F2O3/c11-7-4-8(12)6-9(5-7)15-3-1-2-10(13)14/h1-2,4-6H,3H2,(H,13,14)
InChIKeyWXCHPOXOMSPCIQ-UHFFFAOYSA-N
MW214.17 g/mol
LogP1.98
Rot. Bonds4

About 4-(3,5-difluorophenoxy)but-2-enoic acid

4-(3,5-difluorophenoxy)but-2-enoic acid (PubChem CID 76949345) has the molecular formula C10H8F2O3 and a molecular weight of 214.17 g/mol. Its IUPAC name is 4-(3,5-difluorophenoxy)but-2-enoic acid.

Molecular Properties

Compound Name4-(3,5-difluorophenoxy)but-2-enoic acid
PubChem CID76949345
Molecular FormulaC10H8F2O3
Molecular Weight214.17 g/mol
Exact Mass214.04
IUPAC Name4-(3,5-difluorophenoxy)but-2-enoic acid
SMILESO=C(O)C=CCOc1cc(F)cc(F)c1
InChIInChI=1S/C10H8F2O3/c11-7-4-8(12)6-9(5-7)15-3-1-2-10(13)14/h1-2,4-6H,3H2,(H,13,14)
InChIKeyWXCHPOXOMSPCIQ-UHFFFAOYSA-N
XLogP1.98
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.17
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(3,5-difluorophenoxy)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,5-difluorophenoxy)but-2-enoic acid?
The IUPAC name of 4-(3,5-difluorophenoxy)but-2-enoic acid (CID 76949345) is 4-(3,5-difluorophenoxy)but-2-enoic acid.
What is the SMILES notation for 4-(3,5-difluorophenoxy)but-2-enoic acid?
The canonical SMILES for 4-(3,5-difluorophenoxy)but-2-enoic acid is O=C(O)C=CCOc1cc(F)cc(F)c1.
What is the InChIKey of 4-(3,5-difluorophenoxy)but-2-enoic acid?
The InChIKey is WXCHPOXOMSPCIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2O3/c11-7-4-8(12)6-9(5-7)15-3-1-2-10(13)14/h1-2,4-6H,3H2,(H,13,14).
What are the key properties of 4-(3,5-difluorophenoxy)but-2-enoic acid?
4-(3,5-difluorophenoxy)but-2-enoic acid has a molecular weight of 214.17 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluorophenoxy)but-2-enoic acid is sourced from PubChem (CID 76949345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).