C15H16O5 — CID 114472911
(E)-3-[6-(3-methylbut-3-enoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid (PubChem CID 114472911) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (E)-3-[6-(3-methylbut-3-enoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(3-methylbut-3-enoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114472911 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (E)-3-[6-(3-methylbut-3-enoxy)-1,3-benzodioxol-5-yl]prop-2-enoic acid |
| SMILES | C=C(C)CCOc1cc2c(cc1/C=C/C(=O)O)OCO2 |
| InChI | InChI=1S/C15H16O5/c1-10(2)5-6-18-12-8-14-13(19-9-20-14)7-11(12)3-4-15(16)17/h3-4,7-8H,1,5-6,9H2,2H3,(H,16,17)/b4-3+ |
| InChIKey | BAKALVQPONJFGN-ONEGZZNKSA-N |
| XLogP | 2.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|