C14H15ClO6 — CID 104666587
2-[2-[(E)-2-carboxyethenyl]-4-chloro-6-methoxyphenoxy]butanoic acid (PubChem CID 104666587) has the molecular formula C14H15ClO6 and a molecular weight of 314.72 g/mol. Its IUPAC name is 2-[2-[(E)-2-carboxyethenyl]-4-chloro-6-methoxyphenoxy]butanoic acid.
| Compound Name | 2-[2-[(E)-2-carboxyethenyl]-4-chloro-6-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 104666587 |
| Molecular Formula | C14H15ClO6 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[2-[(E)-2-carboxyethenyl]-4-chloro-6-methoxyphenoxy]butanoic acid |
| SMILES | CCC(Oc1c(/C=C/C(=O)O)cc(Cl)cc1OC)C(=O)O |
| InChI | InChI=1S/C14H15ClO6/c1-3-10(14(18)19)21-13-8(4-5-12(16)17)6-9(15)7-11(13)20-2/h4-7,10H,3H2,1-2H3,(H,16,17)(H,18,19)/b5-4+ |
| InChIKey | MMZBYUISSRLBSW-SNAWJCMRSA-N |
| XLogP | 2.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|