C13H11Cl3O4 — CID 104666577
(E)-3-[5-chloro-2-[(Z)-2,3-dichloroprop-2-enoxy]-3-methoxyphenyl]prop-2-enoic acid (PubChem CID 104666577) has the molecular formula C13H11Cl3O4 and a molecular weight of 337.59 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-[(Z)-2,3-dichloroprop-2-enoxy]-3-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-2-[(Z)-2,3-dichloroprop-2-enoxy]-3-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104666577 |
| Molecular Formula | C13H11Cl3O4 |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | (E)-3-[5-chloro-2-[(Z)-2,3-dichloroprop-2-enoxy]-3-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(Cl)cc(/C=C/C(=O)O)c1OC/C(Cl)=C/Cl |
| InChI | InChI=1S/C13H11Cl3O4/c1-19-11-5-9(15)4-8(2-3-12(17)18)13(11)20-7-10(16)6-14/h2-6H,7H2,1H3,(H,17,18)/b3-2+,10-6- |
| InChIKey | ZOGAAXUIVIUICU-ZHPPZBFFSA-N |
| XLogP | 4.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|