C12H10ClNO4 — CID 104666638
(E)-3-[5-chloro-2-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoic acid (PubChem CID 104666638) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-2-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104666638 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (E)-3-[5-chloro-2-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(Cl)cc(/C=C/C(=O)O)c1OCC#N |
| InChI | InChI=1S/C12H10ClNO4/c1-17-10-7-9(13)6-8(2-3-11(15)16)12(10)18-5-4-14/h2-3,6-7H,5H2,1H3,(H,15,16)/b3-2+ |
| InChIKey | VWDFLHURONQLOA-NSCUHMNNSA-N |
| XLogP | 2.35 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|