C19H14ClN3O4 — CID 4560575
2-[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile (PubChem CID 4560575) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is 2-[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 4560575 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(Cl)cc(C=C2C(=O)NN(c3ccccc3)C2=O)c1OCC#N |
| InChI | InChI=1S/C19H14ClN3O4/c1-26-16-11-13(20)9-12(17(16)27-8-7-21)10-15-18(24)22-23(19(15)25)14-5-3-2-4-6-14/h2-6,9-11H,8H2,1H3,(H,22,24) |
| InChIKey | PZDDJKFRJDHZQZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|