C18H12BrN3O3 — CID 3416958
2-[2-bromo-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetonitrile (PubChem CID 3416958) has the molecular formula C18H12BrN3O3 and a molecular weight of 398.22 g/mol. Its IUPAC name is 2-[2-bromo-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 3416958 |
| Molecular Formula | C18H12BrN3O3 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 2-[2-bromo-4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(C=C2C(=O)NN(c3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C18H12BrN3O3/c19-15-11-12(6-7-16(15)25-9-8-20)10-14-17(23)21-22(18(14)24)13-4-2-1-3-5-13/h1-7,10-11H,9H2,(H,21,23) |
| InChIKey | LJIIXVGDRGBODJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|