C18H14Br2N2O3 — CID 6082627
(4Z)-4-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 6082627) has the molecular formula C18H14Br2N2O3 and a molecular weight of 466.13 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 6082627 |
| Molecular Formula | C18H14Br2N2O3 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | (4Z)-4-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | CCOc1c(Br)cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C18H14Br2N2O3/c1-2-25-16-14(19)9-11(10-15(16)20)8-13-17(23)21-22(18(13)24)12-6-4-3-5-7-12/h3-10H,2H2,1H3,(H,21,23)/b13-8- |
| InChIKey | UBDTXVLZQHIXIM-JYRVWZFOSA-N |
| XLogP | 4.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|