C19H15BrN2O3 — CID 3886806
4-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 3886806) has the molecular formula C19H15BrN2O3 and a molecular weight of 399.24 g/mol. Its IUPAC name is 4-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 3886806 |
| Molecular Formula | C19H15BrN2O3 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 4-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | C=CCOc1ccc(C=C2C(=O)NN(c3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C19H15BrN2O3/c1-2-10-25-17-9-8-13(12-16(17)20)11-15-18(23)21-22(19(15)24)14-6-4-3-5-7-14/h2-9,11-12H,1,10H2,(H,21,23) |
| InChIKey | HNJFFTLGYNSGQR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|