C24H16Br2N2O5 — CID 126404196
3-[[2,6-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 126404196) has the molecular formula C24H16Br2N2O5 and a molecular weight of 572.21 g/mol. Its IUPAC name is 3-[[2,6-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2,6-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126404196 |
| Molecular Formula | C24H16Br2N2O5 |
| Molecular Weight | 572.21 g/mol |
| Exact Mass | 569.94 |
| IUPAC Name | 3-[[2,6-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C\c1cc(Br)c(OCc2cccc(C(=O)O)c2)c(Br)c1 |
| InChI | InChI=1S/C24H16Br2N2O5/c25-19-11-15(10-18-22(29)27-28(23(18)30)17-7-2-1-3-8-17)12-20(26)21(19)33-13-14-5-4-6-16(9-14)24(31)32/h1-12H,13H2,(H,27,29)(H,31,32)/b18-10- |
| InChIKey | LJOLTXMEGFYPGT-ZDLGFXPLSA-N |
| XLogP | 4.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|