C25H18Br2N2O6 — CID 126406065
3-[[2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126406065) has the molecular formula C25H18Br2N2O6 and a molecular weight of 602.24 g/mol. Its IUPAC name is 3-[[2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126406065 |
| Molecular Formula | C25H18Br2N2O6 |
| Molecular Weight | 602.24 g/mol |
| Exact Mass | 599.95 |
| IUPAC Name | 3-[[2,3-dibromo-4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c(Br)c(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H18Br2N2O6/c1-34-19-12-16(11-18-23(30)28-29(24(18)31)17-8-3-2-4-9-17)20(26)21(27)22(19)35-13-14-6-5-7-15(10-14)25(32)33/h2-12H,13H2,1H3,(H,28,30)(H,32,33)/b18-11- |
| InChIKey | YZQXCYMILDTRSA-WQRHYEAKSA-N |
| XLogP | 4.96 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|