C24H17BrClN3O6 — CID 126403940
(4Z)-4-[[2-bromo-3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 126403940) has the molecular formula C24H17BrClN3O6 and a molecular weight of 558.77 g/mol. Its IUPAC name is (4Z)-4-[[2-bromo-3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[2-bromo-3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 126403940 |
| Molecular Formula | C24H17BrClN3O6 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 557.00 |
| IUPAC Name | (4Z)-4-[[2-bromo-3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | COc1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c(Br)c(Cl)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17BrClN3O6/c1-34-19-12-15(11-18-23(30)27-28(24(18)31)16-5-3-2-4-6-16)20(25)21(26)22(19)35-13-14-7-9-17(10-8-14)29(32)33/h2-12H,13H2,1H3,(H,27,30)/b18-11- |
| InChIKey | HWTSGVQNTPDESI-WQRHYEAKSA-N |
| XLogP | 5.06 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|