C25H19N3O8 — CID 3257387
3-[[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 3257387) has the molecular formula C25H19N3O8 and a molecular weight of 489.44 g/mol. Its IUPAC name is 3-[[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3257387 |
| Molecular Formula | C25H19N3O8 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 3-[[4-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxy-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=C2C(=O)NN(c3ccccc3)C2=O)cc([N+](=O)[O-])c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H19N3O8/c1-35-21-13-16(11-19-23(29)26-27(24(19)30)18-8-3-2-4-9-18)12-20(28(33)34)22(21)36-14-15-6-5-7-17(10-15)25(31)32/h2-13H,14H2,1H3,(H,26,29)(H,31,32) |
| InChIKey | NXKFLOZODXZKRY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|