C24H16ClN3O7 — CID 3972879
3-[[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 3972879) has the molecular formula C24H16ClN3O7 and a molecular weight of 493.86 g/mol. Its IUPAC name is 3-[[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3972879 |
| Molecular Formula | C24H16ClN3O7 |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 3-[[4-chloro-2-[(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1cc(Cl)cc([N+](=O)[O-])c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H16ClN3O7/c25-17-10-16(11-19-22(29)26-27(23(19)30)18-7-2-1-3-8-18)21(20(12-17)28(33)34)35-13-14-5-4-6-15(9-14)24(31)32/h1-12H,13H2,(H,26,29)(H,31,32) |
| InChIKey | QDQABOKYANXUSB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|