C14H16ClNO5 — CID 76977017
3-[4-(1-amino-1-oxobutan-2-yl)oxy-3-chloro-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 76977017) has the molecular formula C14H16ClNO5 and a molecular weight of 313.74 g/mol. Its IUPAC name is 3-[4-(1-amino-1-oxobutan-2-yl)oxy-3-chloro-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(1-amino-1-oxobutan-2-yl)oxy-3-chloro-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76977017 |
| Molecular Formula | C14H16ClNO5 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-[4-(1-amino-1-oxobutan-2-yl)oxy-3-chloro-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | CCC(Oc1c(Cl)cc(C=CC(=O)O)cc1OC)C(N)=O |
| InChI | InChI=1S/C14H16ClNO5/c1-3-10(14(16)19)21-13-9(15)6-8(4-5-12(17)18)7-11(13)20-2/h4-7,10H,3H2,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | KISQNHSVOAEGDH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|