C13H12F2O5 — CID 79888128
2-[4-(2-carboxyethenyl)-2,6-difluorophenoxy]butanoic acid (PubChem CID 79888128) has the molecular formula C13H12F2O5 and a molecular weight of 286.23 g/mol. Its IUPAC name is 2-[4-(2-carboxyethenyl)-2,6-difluorophenoxy]butanoic acid.
| Compound Name | 2-[4-(2-carboxyethenyl)-2,6-difluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 79888128 |
| Molecular Formula | C13H12F2O5 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[4-(2-carboxyethenyl)-2,6-difluorophenoxy]butanoic acid |
| SMILES | CCC(Oc1c(F)cc(C=CC(=O)O)cc1F)C(=O)O |
| InChI | InChI=1S/C13H12F2O5/c1-2-10(13(18)19)20-12-8(14)5-7(6-9(12)15)3-4-11(16)17/h3-6,10H,2H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | JZQMCKIAAZVRLX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|