3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid

C17H24O4 — CID 54312712

IUPAC3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid
SMILESCCC(C)Oc1cc(C=CC(=O)O)cc(OC(C)CC)c1
InChIInChI=1S/C17H24O4/c1-5-12(3)20-15-9-14(7-8-17(18)19)10-16(11-15)21-13(4)6-2/h7-13H,5-6H2,1-4H3,(H,18,19)
InChIKeySMANSMZQJQPLDR-UHFFFAOYSA-N
MW292.38 g/mol
LogP4.14
Rot. Bonds8

About 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid

3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid (PubChem CID 54312712) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid.

Molecular Properties

Compound Name3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid
PubChem CID54312712
Molecular FormulaC17H24O4
Molecular Weight292.38 g/mol
Exact Mass292.17
IUPAC Name3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid
SMILESCCC(C)Oc1cc(C=CC(=O)O)cc(OC(C)CC)c1
InChIInChI=1S/C17H24O4/c1-5-12(3)20-15-9-14(7-8-17(18)19)10-16(11-15)21-13(4)6-2/h7-13H,5-6H2,1-4H3,(H,18,19)
InChIKeySMANSMZQJQPLDR-UHFFFAOYSA-N
XLogP4.14
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.38
LogP ≤ 54.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid?
The IUPAC name of 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid (CID 54312712) is 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid.
What is the SMILES notation for 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid?
The canonical SMILES for 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid is CCC(C)Oc1cc(C=CC(=O)O)cc(OC(C)CC)c1.
What is the InChIKey of 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid?
The InChIKey is SMANSMZQJQPLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c1-5-12(3)20-15-9-14(7-8-17(18)19)10-16(11-15)21-13(4)6-2/h7-13H,5-6H2,1-4H3,(H,18,19).
What are the key properties of 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid?
3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid has a molecular weight of 292.38 g/mol, XLogP of 4.14, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-di(butan-2-yloxy)phenyl]prop-2-enoic acid is sourced from PubChem (CID 54312712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).