C17H24O3 — CID 130331796
butyl (E)-3-(4-butan-2-yloxyphenyl)prop-2-enoate (PubChem CID 130331796) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is butyl (E)-3-(4-butan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | butyl (E)-3-(4-butan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 130331796 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | butyl (E)-3-(4-butan-2-yloxyphenyl)prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc(OC(C)CC)cc1 |
| InChI | InChI=1S/C17H24O3/c1-4-6-13-19-17(18)12-9-15-7-10-16(11-8-15)20-14(3)5-2/h7-12,14H,4-6,13H2,1-3H3/b12-9+ |
| InChIKey | IJWHSRDKWJXQCB-FMIVXFBMSA-N |
| XLogP | 4.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|