About 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate
3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate (PubChem CID 140807784) has the molecular formula C21H32O3
and a molecular weight of 332.48 g/mol. Its IUPAC name is 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate |
| PubChem CID | 140807784 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate |
| SMILES | CCCC(CC)CCOC(=O)C=Cc1cccc(OC(C)CC)c1 |
| InChI | InChI=1S/C21H32O3/c1-5-9-18(7-3)14-15-23-21(22)13-12-19-10-8-11-20(16-19)24-17(4)6-2/h8,10-13,16-18H,5-7,9,14-15H2,1-4H3 |
| InChIKey | BHNXICBKZYFICO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate?
The IUPAC name of 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate (CID 140807784) is 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate.
What is the SMILES notation for 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate?
The canonical SMILES for 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate is CCCC(CC)CCOC(=O)C=Cc1cccc(OC(C)CC)c1.
What is the InChIKey of 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate?
The InChIKey is BHNXICBKZYFICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O3/c1-5-9-18(7-3)14-15-23-21(22)13-12-19-10-8-11-20(16-19)24-17(4)6-2/h8,10-13,16-18H,5-7,9,14-15H2,1-4H3.
What are the key properties of 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate?
3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate has a molecular weight of 332.48 g/mol, XLogP of 5.64, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylhexyl 3-(3-butan-2-yloxyphenyl)prop-2-enoate is sourced from PubChem (CID 140807784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).