C13H15BrO3 — CID 76983152
3-(3-bromo-4-butan-2-yloxyphenyl)prop-2-enoic acid (PubChem CID 76983152) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is 3-(3-bromo-4-butan-2-yloxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(3-bromo-4-butan-2-yloxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 76983152 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 3-(3-bromo-4-butan-2-yloxyphenyl)prop-2-enoic acid |
| SMILES | CCC(C)Oc1ccc(C=CC(=O)O)cc1Br |
| InChI | InChI=1S/C13H15BrO3/c1-3-9(2)17-12-6-4-10(8-11(12)14)5-7-13(15)16/h4-9H,3H2,1-2H3,(H,15,16) |
| InChIKey | ZJZLWQOCPHJZRK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|