C27H44O5 — CID 54188307
3-[3,4,5-tri(hexan-2-yloxy)phenyl]prop-2-enoic acid (PubChem CID 54188307) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is 3-[3,4,5-tri(hexan-2-yloxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,4,5-tri(hexan-2-yloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54188307 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 3-[3,4,5-tri(hexan-2-yloxy)phenyl]prop-2-enoic acid |
| SMILES | CCCCC(C)Oc1cc(C=CC(=O)O)cc(OC(C)CCCC)c1OC(C)CCCC |
| InChI | InChI=1S/C27H44O5/c1-7-10-13-20(4)30-24-18-23(16-17-26(28)29)19-25(31-21(5)14-11-8-2)27(24)32-22(6)15-12-9-3/h16-22H,7-15H2,1-6H3,(H,28,29) |
| InChIKey | PGRUZDCMVNNYHP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|