C14H15BrO6 — CID 76914316
2-[2-bromo-4-(2-carboxyethenyl)-6-ethoxyphenoxy]propanoic acid (PubChem CID 76914316) has the molecular formula C14H15BrO6 and a molecular weight of 359.17 g/mol. Its IUPAC name is 2-[2-bromo-4-(2-carboxyethenyl)-6-ethoxyphenoxy]propanoic acid.
| Compound Name | 2-[2-bromo-4-(2-carboxyethenyl)-6-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 76914316 |
| Molecular Formula | C14H15BrO6 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 2-[2-bromo-4-(2-carboxyethenyl)-6-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(C=CC(=O)O)cc(Br)c1OC(C)C(=O)O |
| InChI | InChI=1S/C14H15BrO6/c1-3-20-11-7-9(4-5-12(16)17)6-10(15)13(11)21-8(2)14(18)19/h4-8H,3H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | DKKPRNJJYSDSGT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|