C13H13Br2NO4 — CID 107739291
(E)-3-[3,5-dibromo-4-[1-(methylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 107739291) has the molecular formula C13H13Br2NO4 and a molecular weight of 407.06 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-[1-(methylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dibromo-4-[1-(methylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107739291 |
| Molecular Formula | C13H13Br2NO4 |
| Molecular Weight | 407.06 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-[1-(methylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | CNC(=O)C(C)Oc1c(Br)cc(/C=C/C(=O)O)cc1Br |
| InChI | InChI=1S/C13H13Br2NO4/c1-7(13(19)16-2)20-12-9(14)5-8(6-10(12)15)3-4-11(17)18/h3-7H,1-2H3,(H,16,19)(H,17,18)/b4-3+ |
| InChIKey | AXSXEWAQDOQHQC-ONEGZZNKSA-N |
| XLogP | 2.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.06 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|