C22H24O4S — CID 175150894
2-[2,6-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]butanoic acid (PubChem CID 175150894) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]butanoic acid.
| Compound Name | 2-[2,6-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 175150894 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[2,6-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1c(C)cc(C=CC(=O)c2ccc(SC)cc2)cc1C)C(=O)O |
| InChI | InChI=1S/C22H24O4S/c1-5-20(22(24)25)26-21-14(2)12-16(13-15(21)3)6-11-19(23)17-7-9-18(27-4)10-8-17/h6-13,20H,5H2,1-4H3,(H,24,25) |
| InChIKey | NUTNWDSYPXIWQM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|