C20H21F2NO4S — CID 9447533
4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 9447533) has the molecular formula C20H21F2NO4S and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 9447533 |
| Molecular Formula | C20H21F2NO4S |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 4-[(E)-3-[4-(difluoromethoxy)-3,5-dimethylphenyl]prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(/C=C/C(=O)c2ccc(S(=O)(=O)N(C)C)cc2)cc(C)c1OC(F)F |
| InChI | InChI=1S/C20H21F2NO4S/c1-13-11-15(12-14(2)19(13)27-20(21)22)5-10-18(24)16-6-8-17(9-7-16)28(25,26)23(3)4/h5-12,20H,1-4H3/b10-5+ |
| InChIKey | WGTGNCMFXKTKKQ-BJMVGYQFSA-N |
| XLogP | 4.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|