C19H18F2O4 — CID 8832766
(E)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 8832766) has the molecular formula C19H18F2O4 and a molecular weight of 348.35 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8832766 |
| Molecular Formula | C19H18F2O4 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(C)cc2)cc(OC)c1OC(F)F |
| InChI | InChI=1S/C19H18F2O4/c1-12-4-7-14(8-5-12)15(22)9-6-13-10-16(23-2)18(25-19(20)21)17(11-13)24-3/h4-11,19H,1-3H3/b9-6+ |
| InChIKey | RSTNELZFJDKKSL-RMKNXTFCSA-N |
| XLogP | 4.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|