C18H14ClF2NO6 — CID 8854674
(E)-1-(4-chloro-3-nitrophenyl)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]prop-2-en-1-one (PubChem CID 8854674) has the molecular formula C18H14ClF2NO6 and a molecular weight of 413.76 g/mol. Its IUPAC name is (E)-1-(4-chloro-3-nitrophenyl)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chloro-3-nitrophenyl)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8854674 |
| Molecular Formula | C18H14ClF2NO6 |
| Molecular Weight | 413.76 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | (E)-1-(4-chloro-3-nitrophenyl)-3-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc(OC)c1OC(F)F |
| InChI | InChI=1S/C18H14ClF2NO6/c1-26-15-7-10(8-16(27-2)17(15)28-18(20)21)3-6-14(23)11-4-5-12(19)13(9-11)22(24)25/h3-9,18H,1-2H3/b6-3+ |
| InChIKey | TVFDJSWYAOXTHZ-ZZXKWVIFSA-N |
| XLogP | 4.76 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|