C15H21NO5 — CID 64661992
2-[[6-(2-aminobutyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid (PubChem CID 64661992) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[[6-(2-aminobutyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid.
| Compound Name | 2-[[6-(2-aminobutyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 64661992 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[[6-(2-aminobutyl)-1,3-benzodioxol-5-yl]oxy]butanoic acid |
| SMILES | CCC(N)Cc1cc2c(cc1OC(CC)C(=O)O)OCO2 |
| InChI | InChI=1S/C15H21NO5/c1-3-10(16)5-9-6-13-14(20-8-19-13)7-12(9)21-11(4-2)15(17)18/h6-7,10-11H,3-5,8,16H2,1-2H3,(H,17,18) |
| InChIKey | DQUMIYGHOUIZKJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |