C14H14O3 — CID 58121338
(E)-3-(3-but-2-ynoxy-4-methylphenyl)prop-2-enoic acid (PubChem CID 58121338) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (E)-3-(3-but-2-ynoxy-4-methylphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3-but-2-ynoxy-4-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 58121338 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (E)-3-(3-but-2-ynoxy-4-methylphenyl)prop-2-enoic acid |
| SMILES | CC#CCOc1cc(/C=C/C(=O)O)ccc1C |
| InChI | InChI=1S/C14H14O3/c1-3-4-9-17-13-10-12(6-5-11(13)2)7-8-14(15)16/h5-8,10H,9H2,1-2H3,(H,15,16)/b8-7+ |
| InChIKey | CYMWTUYGZXCCAS-BQYQJAHWSA-N |
| XLogP | 2.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|