C16H12Cl2O5S — CID 170872333
(E)-3-[3,5-dichloro-2-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid (PubChem CID 170872333) has the molecular formula C16H12Cl2O5S and a molecular weight of 387.24 g/mol. Its IUPAC name is (E)-3-[3,5-dichloro-2-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dichloro-2-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170872333 |
| Molecular Formula | C16H12Cl2O5S |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | (E)-3-[3,5-dichloro-2-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Cl)cc(Cl)cc2/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C16H12Cl2O5S/c1-10-2-5-13(6-3-10)24(21,22)23-16-11(4-7-15(19)20)8-12(17)9-14(16)18/h2-9H,1H3,(H,19,20)/b7-4+ |
| InChIKey | BUALYRKJHBTOBQ-QPJJXVBHSA-N |
| XLogP | 4.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|