C21H17Cl2NO3S2 — CID 2742136
[2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 2742136) has the molecular formula C21H17Cl2NO3S2 and a molecular weight of 466.41 g/mol. Its IUPAC name is [2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2742136 |
| Molecular Formula | C21H17Cl2NO3S2 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | [2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CSc1cccc(/N=C/c2cc(Cl)cc(Cl)c2OS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C21H17Cl2NO3S2/c1-14-6-8-19(9-7-14)29(25,26)27-21-15(10-16(22)11-20(21)23)13-24-17-4-3-5-18(12-17)28-2/h3-13H,1-2H3/b24-13+ |
| InChIKey | YLLFXANUGSHWPN-ZMOGYAJESA-N |
| XLogP | 6.54 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|