C24H21Cl2NO5S — CID 23908283
[2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 23908283) has the molecular formula C24H21Cl2NO5S and a molecular weight of 506.41 g/mol. Its IUPAC name is [2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 23908283 |
| Molecular Formula | C24H21Cl2NO5S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | [2,4-dichloro-6-[(3-methylsulfanylphenyl)iminomethyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(Cl)cc(Cl)cc2/C=N/c2cccc(SC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H21Cl2NO5S/c1-29-20-9-14(10-21(30-2)23(20)31-3)24(28)32-22-15(8-16(25)11-19(22)26)13-27-17-6-5-7-18(12-17)33-4/h5-13H,1-4H3/b27-13+ |
| InChIKey | AHAWHPZMRFIOQO-UVHMKAGCSA-N |
| XLogP | 6.71 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|