C18H17BrClNO4 — CID 1478246
ethyl 2-[4-bromo-2-[(3-chlorophenyl)iminomethyl]-6-methoxyphenoxy]acetate (PubChem CID 1478246) has the molecular formula C18H17BrClNO4 and a molecular weight of 426.69 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(3-chlorophenyl)iminomethyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(3-chlorophenyl)iminomethyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 1478246 |
| Molecular Formula | C18H17BrClNO4 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(3-chlorophenyl)iminomethyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(/C=N/c2cccc(Cl)c2)cc(Br)cc1OC |
| InChI | InChI=1S/C18H17BrClNO4/c1-3-24-17(22)11-25-18-12(7-13(19)8-16(18)23-2)10-21-15-6-4-5-14(20)9-15/h4-10H,3,11H2,1-2H3/b21-10+ |
| InChIKey | CPQBCOAVFGTSEX-UFFVCSGVSA-N |
| XLogP | 4.80 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|