C18H19Cl2NO2 — CID 126391506
1-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(3-chlorophenyl)methanimine (PubChem CID 126391506) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 1-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(3-chlorophenyl)methanimine.
| Compound Name | 1-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(3-chlorophenyl)methanimine |
|---|---|
| PubChem CID | 126391506 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(3-chlorophenyl)methanimine |
| SMILES | CC[C@@H](C)Oc1c(Cl)cc(/C=N/c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H19Cl2NO2/c1-4-12(2)23-18-16(20)8-13(9-17(18)22-3)11-21-15-7-5-6-14(19)10-15/h5-12H,4H2,1-3H3/b21-11+/t12-/m1/s1 |
| InChIKey | OXKQUXUBCIDYJC-KIHMUJGBSA-N |
| XLogP | 5.93 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|